3-Iodothyronamine
From Wikipedia, the free encyclopedia
| 3-Iodothyronamine | |
|---|---|
 |
|
| IUPAC name | 4-[4-(2-Amino-ethyl)-2-iodo-phenoxy]-phenol |
| Other names | T1AM |
| Identifiers | |
| CAS number | [] |
| SMILES | OC1=CC=C(OC2=C(I)C=C(CCN)C=C2)C=C1 |
| Properties | |
| Molecular formula | C14H14INO2 |
| Molar mass | 355.17 g/mol |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
The thyronamine 3-iodothyronamine (T1AM) is an endogenous, high-affinity ligand for the trace amine-associated receptor TAAR1 (TAR1, TA1), a G protein-coupled receptor. In rodents, T1AM causes a rapid drop in body temperature when injected.
[edit] See also
[edit] External links
[edit] References
- Nat. Med. 10(6):638-642 (2004) 3-Iodothyronamine is an endogenous and rapid-acting derivative of thyroid hormone PMID 15146179
- J. Med. Chem. 49(3):1101-1112 (2006) Trace amine-associated receptor agonists: synthesis and evaluation of thyronamines and related analogues PMID 16451074
