Flavin mononucleotide
From Wikipedia, the free encyclopedia
| Flavin mononucleotide | |
|---|---|
 |
|
| IUPAC name | Phosphoric acid mono-[5-(7,8-dimethyl-2,4-dioxo-3,4-dihydro-2H-benzo[g]pteridin-10-yl)-2,3,4-trihydroxy-pentyl] ester |
| Other names | FMN |
| Identifiers | |
| CAS number | [] |
| PubChem | |
| MeSH | |
| SMILES | O=C(N3)C2=NC1=CC(C)=C(C)C=C1N(C[C@H](O)[C@H](O)[C@@H](COP(O)(O)=O)O)C2=NC3=O |
| Properties | |
| Molecular formula | C17H21N4O9P |
| Molar mass | 456.344 g/mol |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
Flavin mononucleotide or FMN is derived from riboflavin (vitamin B2) and functions as cofactor of various oxidoreductases. During catalytic cycle, the reversible interconversion of oxidized (FMN), semiquinone (FMNH•) and reduced (FMNH2) forms occurs.
[edit] External link
 |
This biochemistry article is a stub. You can help Wikipedia by expanding it. |
