Benzimidazole (data page)
From Wikipedia, the free encyclopedia
| The complete data for Benzimidazole | ||||||||||||||||
   |
General information Chemical formula: C7H6N2
Molecular mass: 118.136 [1] g·mol-1 Systematic name: 1H-benzoimidazole [1] Abbreviations: Hbim, Hbzim [1] Synonyms: 1,3-benzodiazole 1,3-diazaindene 3-azaindole Azindole Benziminazole Benzoglyoxaline Benzoimidazole N, N'-methenyl-o-phenylenediamine |
|||||||||||||||
| Database data | ||||||||||||||||
| SMILES: C1=CC=C2C(=C1)NC=N2 [1] InChI=1/C7H6N2/c1-2-4-7-6(3-1)8-5-9-7/h1-5H,(H,8,9)/f/h8H [1]
|
||||||||||||||||
| Physical properties | ||||||||||||||||
|
||||||||||||||||
| Hazard properties | ||||||||||||||||
|
||||||||||||||||
| Chemical properties | ||||||||||||||||
|
||||||||||||||||
| Pharmacological properties | ||||||||||||||||
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) | ||||||||||||||||
