Beta-Methyl-phenethylamine
From Wikipedia, the free encyclopedia
Beta-Methyl-phenethylamine | |
---|---|
![]() |
|
IUPAC name | 2-Phenylpropan-1-amine |
Other names | beta-Methylbenzeneethanamine beta-Methylphenethylamine beta-Methylphenylethylamine Phenethylamine, beta-methyl- beta-Phenylpropylamine 2-Phenylpropylamine 1-Propanamine, 2-phenyl- Propylamine, 2-phenyl- 1-Phenyl-1-methyl-2-amino-ethane 1-Phenyl-1-methyl-2-aminoethane 1-Amino-2-phenylpropane |
Molecular formula | C9H13N |
Identifiers | |
CAS number | [ | ]
PubChem | |
SMILES | CC(CN)C1=CC=CC=C1 |
InChI | InChI=1/C9H13N/c1-8(7-10)9-5-3-2-4-6-9/h2-6,8H,7,10H2,1H3 |
Properties | |
Molar mass | 135.206g/mol |
Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
beta-Methyl-phenethylamine is a designer drug related to amphetamine. The chemical is also known under the name diamondina.[citation needed]