Chlorothalonil
From Wikipedia, the free encyclopedia
| Chlorothalonil | |
|---|---|
 |
|
| General | |
| Systematic name | 2,4,5,6-tetrachloro- 1,3-benzenedicarbonitrile |
| Other names | chlorothalonil tetrachloroisophthalonitrile |
| Molecular formula | C8Cl4N2 |
| SMILES | N#CC1=C(Cl)C(C#N)=C(Cl)C(Cl)=C1Cl |
| Molar mass | 265.91 g mol−1 |
| Appearance | ? |
| CAS number | [1897-45-6] |
| Properties | |
| Density and phase | 1.8 g cm−3, solid |
| Solubility in water | 0.06 g/100 ml |
| Melting point | 250 °C (523 K) |
| Boiling point | ?°C (? K) |
| Viscosity | ? cP at ?°C |
| Structure | |
| Crystal structure | ? |
| Dipole moment | ? D |
| Hazards | |
| MSDS | External MSDS |
| Main hazards | ? |
| NFPA 704 | |
| Flash point | ?°C |
| R/S statement | R: ? S: ? |
| RTECS number | NT2600000 |
| Supplementary data page | |
| Structure and properties |
n, εr, etc. |
| Thermodynamic data |
Phase behaviour Solid, liquid, gas |
| Spectral data | UV, IR, NMR, MS |
| Related compounds | |
| Related nitriles | benzonitrile |
| Related organochlorides | hexachlorobenzene dichlorobenzene chlorobenzene |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
[edit] Uses
Chlorothalonil is a fungicide used
- to prevent biofouling on ships.
- as an agricultural fungicide. It belongs to the larger group of Phthalonitriles.
[edit] External links
 |
This article about an organic compound is a stub. You can help Wikipedia by expanding it. |
