3-Amino-5-nitrosalicylic acid
From Wikipedia, the free encyclopedia
| 3-Amino-5-nitrosalicylic acid | |
|---|---|
  |
|
| Systematic name | 3-Amino-5-nitrosalicylic acid |
| Chemical formula | C7H6N2O5 |
| Molecular mass | 198.13294 g/mol |
| Density | 1.730 ± 0.06 g/cm³ |
| Melting point | xx.x °C |
| Boiling point | xx.x °C |
| CAS number | [xx-xx-xx] |
| SMILES | Nc1cc(cc(C(O)=O)c1O)[N+]([O-])=O |
| Disclaimer and references | |
3-Amino-5-nitrosalicylic acid is an aromatic compound that absorbs light strongly at 540 nm. It is produced when 3,5-dinitrosalicylic acid reacts with a reducing sugar.
[edit] External links
 |
This article about an amine is a stub. You can help Wikipedia by expanding it. |
