Geranic acid
From Wikipedia, the free encyclopedia
| Geranic acid | |
|---|---|
 |
|
| General | |
| Systematic name | 3,7-Dimethyl-2,6-octadienoic acid |
| Other names | Geranic acid |
| Molecular formula | C10H16O2 |
| SMILES | C/C(C)=C\CC/C(C)=C/C(O)=O |
| Molar mass | 168.24 g/mol |
| Appearance | oily |
| CAS number | 459-80-3 |
| Properties | |
| Density and phase | 0.97 g/cm3, liquid |
| Solubility in water | ? g/100 ml (? °C) |
| Melting point | ? °C (? K) |
| Boiling point | 249-251 °C (522.15-524.15 K) |
| Acidity (pKa) | ? |
| Viscosity | ? cP at ? °C |
| Structure | |
| Molecular shape | ? |
| Coordination geometry | ? |
| Crystal structure | ? |
| Dipole moment | ? D |
| Hazards | |
| MSDS | External MSDS |
| Main hazards | ? |
| Flash point | ? °C |
| R/S statement | R: ? S: ? |
| RTECS number | ? |
| Supplementary data page | |
| Structure & properties | n, εr, etc. |
| Thermodynamic data | Phase behaviour Solid, liquid, gas |
| Spectral data | UV, IR, NMR, MS |
| Related compounds | |
| Related acids | Octanoic acid |
| Related compounds | Geraniol Geranial |
| Except where noted otherwise, data are given for materials in their standard state (at 25°C, 100 kPa) Infobox disclaimer and references |
|
Geranic acid, or 3,7-dimethyl-2,6-octadienoic acid, is a pheromone used by some organisms.
[edit] External links
 |
This article about an organic compound is a stub. You can help Wikipedia by expanding it. |
