Homovanillic acid
From Wikipedia, the free encyclopedia
| Homovanillic acid | |
|---|---|
 |
|
| IUPAC name | 2-(4-Hydroxy-3-methoxy-phenyl)acetic acid |
| Identifiers | |
| CAS number | [] |
| PubChem | |
| MeSH | |
| SMILES | COC1=C(C=CC(=C1)CC(=O)O)O |
| Properties | |
| Molecular formula | C9H10O4 |
| Molar mass | 182.173 |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
Homovanillic acid (HOC6H3(OCH3)CH2COOH; synonyms: 3-Methoxy-4-hydroxyphenyl acetic acid; HVA; 4-Hydroxy-3-methoxy-benzeneacetic acid; 4-Hydroxy-3-methoxyphenylacetic acid) is a major catecholamine metabolite. It is used as a reagent to detect oxidative enzymes.
In psychiatry and neuroscience, brain and cerebrospinal fluid levels of HVA are measured as a marker of metabolic stress caused by 2-deoxy-D-glucose.1
[edit] Notes
- Note 1: Marcelis M, Suckling J, Hofman P, Woodruff P, Bullmore E, van Os J. (2006) Evidence that brain tissue volumes are associated with HVA reactivity to metabolic stress in schizophrenia. Schizophr Res. 86(1-3):45-53. PMID 16806836
 |
This article about an aromatic compound is a stub. You can help Wikipedia by expanding it. |
