N-Acetylmannosamine
From Wikipedia, the free encyclopedia
N-Acetylmannosamine | |
---|---|
![]() |
|
IUPAC name | 2-(Acetylamino)-2-deoxy-β-D-mannopyranose |
Identifiers | |
CAS number | [ | ]
PubChem | |
SMILES | OCC1C(O)C(O)C(NC(C)=O)C(O)O1 |
Properties | |
Molecular formula | C8H15NO6 |
Molar mass | 221.21 g/mol |
Melting point |
118-121 °C |
Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
N-Acetylmannosamine is a monosaccharide involved in a range of metabolic processes. It is an amino sugar that is a constituent of neuraminic acids, glycolipids and glycoproteins, and is used for the synthesis of sialic acid.