Sulfosalicylic acid
From Wikipedia, the free encyclopedia
Sulfosalicylic acid | |
---|---|
![]() |
|
Systematic name | 2-Hydroxy-5-sulfo-benzoic acid |
Chemical formula | C7H6O6S |
Molecular mass | 218.185 g/mol |
Density | x.xxx g/cm³ |
Melting point | xx.x °C |
Boiling point | xx.x °C |
CAS number | [97-05-2] |
SMILES | C1=CC(=C(C=C1S(=O)(=O)O)C(=O)O)O |
Disclaimer and references |
Sulfosalicylic acid is used in urine tests to determine urine protein content. The chemical causes the precipitation of dissolved proteins, which is measured from the degree of turbidity.