Sulfosalicylic acid
From Wikipedia, the free encyclopedia
| Sulfosalicylic acid | |
|---|---|
 |
|
| Systematic name | 2-Hydroxy-5-sulfo-benzoic acid |
| Chemical formula | C7H6O6S |
| Molecular mass | 218.185 g/mol |
| Density | x.xxx g/cm³ |
| Melting point | xx.x °C |
| Boiling point | xx.x °C |
| CAS number | [97-05-2] |
| SMILES | C1=CC(=C(C=C1S(=O)(=O)O)C(=O)O)O |
| Disclaimer and references | |
Sulfosalicylic acid is used in urine tests to determine urine protein content. The chemical causes the precipitation of dissolved proteins, which is measured from the degree of turbidity.
[edit] See also
[edit] External links
 |
This article about an organic compound is a stub. You can help Wikipedia by expanding it. |
