Hasubanonine
From Wikipedia, the free encyclopedia
| Hasubanonine | |
|---|---|
 |
|
| Other names | Hasubanonine |
| Identifiers | |
| CAS number | [] |
| PubChem | |
| SMILES | CN4[C@@](CC2)3[C@@](CC(C(OC)=C3OC)=O)(CC4)C1=C2C=CC(OC)=C1OC |
| Properties | |
| Molecular formula | C21H27NO5 |
| Molar mass | 373.19 g/mol |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
Hasubanonine is a member of the hasubanan family of alkaloids. The alkaloid with an isoquinoline substructure has the molecular formula of C21H27NO5.[1] The enantiomer of the natural product is being studied as a potential painkiller.[2]
[edit] References
 |
This article about a heterocyclic compound is a stub. You can help Wikipedia by expanding it. |
