Pulegone
From Wikipedia, the free encyclopedia
| Pulegone[1] | |
|---|---|
 |
|
| IUPAC name | (R)-5-Methyl-2-(1-methylethylidine)cyclohexanone |
| Other names | p-Menth-4(8)-en-3-one delta-4(8)-p-menthen-3-one |
| Identifiers | |
| CAS number | [] |
| PubChem | |
| SMILES | C[C@@H]1CCC(=C(C)C)C(=O)C1 |
| Properties | |
| Molecular formula | C10H16O |
| Molar mass | 152.23 g/mol |
| Appearance | Colorless oil |
| Density | 0.9346 g/cm3 |
| Boiling point |
224 °C, 497 K, 435 °F |
| Solubility in water | Insoluble |
| Solubility in Ethanol Ether Chloroform |
Miscible |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
Pulegone is a naturally occurring organic compound obtained from the essential oils of a variety of plants such as Nepeta cataria (catnip), Mentha piperita, and pennyroyal.[2][3] It is classified as a monoterpene.
Pulegone is a clear colorless oily liquid and has a pleasant odor similar to pennyroyal, peppermint and camphor. It is used in flavoring agents, in perfumery, and in aromatherapy.
