Benzothiazole (data page)
From Wikipedia, the free encyclopedia
The complete data for Benzothiazole | ||||||||||||||||
![]() ![]() ![]() |
General information![]() Chemical formula: C7H5NS
Molecular mass: 139.19 g·mol-1 Systematic name: 1,3-benzothiazole Synonyms: 1-thia-3-azaindene Benzosulfonazole |
|||||||||||||||
Database data | ||||||||||||||||
SMILES: C1(C=CC=C2)=C2SC=N1 InChI=1/C7H5NS/c1-2-4-7-6(3-1)8-5-9-7/h1-5H
|
||||||||||||||||
Physical properties | ||||||||||||||||
|
||||||||||||||||
Hazard properties | ||||||||||||||||
|
||||||||||||||||
Chemical properties | ||||||||||||||||
|
||||||||||||||||
Pharmacological properties | ||||||||||||||||
Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) |