Abietic acid
From Wikipedia, the free encyclopedia
| Abietic acid | |
|---|---|
 |
|
| General | |
| Systematic name | 13-isopropylpodocarpa-7,13-dien-15-oic acid |
| Other names | Sylvic acid |
| Molecular formula | C19H29COOH |
| SMILES | O=C(O)C1(C2C(C3C(=CC2)C=C(CC3)C(C)C)(CCC1)C)C |
| Molar mass | 302.44 g/mol |
| Appearance | yellow resinous powder, crystals or chunks |
| CAS number | 514-10-3 |
| EINECS number | 208-173-3 |
| Merck number | 13,5 |
| Properties | |
| Density and phase | ? g/cm³, ? |
| Solubility in water | Insoluble |
| Melting point | 173 °C (446 K) |
| Boiling point | 250 °C (523 K) at 9 mmHg |
| Acidity (pKa) | ? |
| Basicity (pKb) | ? |
| Chiral rotation [α]D | ? ° |
| Structure | |
| Crystal structure | ? |
| Dipole moment | ? D |
| Hazards | |
| MSDS | [External MSDS |
| Main hazards | Irritant |
| Flash point | ? °C |
| R/S statement | R: R36 R37 R38 S: S24 S25 |
| RTECS number | TP8580000 |
| Related compounds | |
| Related compounds | ? |
| Except where noted otherwise, data are given for materials in their standard state (at 25°C, 100 kPa) Infobox disclaimer and references |
|
Abietic acid (also known as abietinic acid or sylvic acid), a resin acid, is the primary irritant in pine, isolated from rosin (via isomerization). It is soluble in alcohols, acetone, and ethers. It is used in lacquers, varnishes, and soaps, and for the analysis of resins and the preparation of metal resinates. It is listed in the Toxic Substances Control Act inventory.
Its ester is called an abietate.
Abietic acid is a weak contact allergen, however compounds resulting of its oxidation by air elicit stronger response. It is the primary irritant in pine wood and resin.
